C32H28BrN3O8 — CID 163513241
acetonitrile;5-(bromomethyl)-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione;2-(2,4-dioxocyclohexyl)-5-methylisoindole-1,3-dione (PubChem CID 163513241) has the molecular formula C32H28BrN3O8 and a molecular weight of 662.49 g/mol. Its IUPAC name is acetonitrile;5-(bromomethyl)-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione;2-(2,4-dioxocyclohexyl)-5-methylisoindole-1,3-dione.
| Compound Name | acetonitrile;5-(bromomethyl)-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione;2-(2,4-dioxocyclohexyl)-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 163513241 |
| Molecular Formula | C32H28BrN3O8 |
| Molecular Weight | 662.49 g/mol |
| Exact Mass | 661.11 |
| IUPAC Name | acetonitrile;5-(bromomethyl)-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione;2-(2,4-dioxocyclohexyl)-5-methylisoindole-1,3-dione |
| SMILES | CC#N.Cc1ccc2c(c1)C(=O)N(C1CCC(=O)CC1=O)C2=O.O=C1CCC(N2C(=O)c3ccc(CBr)cc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C15H12BrNO4.C15H13NO4.C2H3N/c16-7-8-1-3-10-11(5-8)15(21)17(14(10)20)12-4-2-9(18)6-13(12)19;1-8-2-4-10-11(6-8)15(20)16(14(10)19)12-5-3-9(17)7-13(12)18;1-2-3/h1,3,5,12H,2,4,6-7H2;2,4,6,12H,3,5,7H2,1H3;1H3 |
| InChIKey | DEMOPWCQDVSTGK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 166.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|