C22H20Cl2N2O4S — CID 167632308
3-[3-[5-(2,6-dichlorophenyl)-3-oxopentyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione (PubChem CID 167632308) has the molecular formula C22H20Cl2N2O4S and a molecular weight of 479.39 g/mol. Its IUPAC name is 3-[3-[5-(2,6-dichlorophenyl)-3-oxopentyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[5-(2,6-dichlorophenyl)-3-oxopentyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167632308 |
| Molecular Formula | C22H20Cl2N2O4S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 3-[3-[5-(2,6-dichlorophenyl)-3-oxopentyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione |
| SMILES | O=C(CCc1scc2c1CN(C1CCC(=O)NC1=O)C2=O)CCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O4S/c23-16-2-1-3-17(24)13(16)6-4-12(27)5-8-19-14-10-26(22(30)15(14)11-31-19)18-7-9-20(28)25-21(18)29/h1-3,11,18H,4-10H2,(H,25,28,29) |
| InChIKey | RDQLQLQSADTKDV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|