C17H15N3O4S2 — CID 162185878
3-[6-oxo-3-[3-oxo-3-(1,3-thiazol-2-yl)propyl]-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione (PubChem CID 162185878) has the molecular formula C17H15N3O4S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 3-[6-oxo-3-[3-oxo-3-(1,3-thiazol-2-yl)propyl]-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-oxo-3-[3-oxo-3-(1,3-thiazol-2-yl)propyl]-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162185878 |
| Molecular Formula | C17H15N3O4S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-[6-oxo-3-[3-oxo-3-(1,3-thiazol-2-yl)propyl]-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(csc3CCC(=O)c3nccs3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C17H15N3O4S2/c21-12(16-18-5-6-25-16)2-3-13-9-7-20(17(24)10(9)8-26-13)11-1-4-14(22)19-15(11)23/h5-6,8,11H,1-4,7H2,(H,19,22,23) |
| InChIKey | ITQHZTPXWYAWPU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|