C17H16N4O4S2 — CID 158559504
3-[3-[3-(4-methylthiadiazol-5-yl)-3-oxopropyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione (PubChem CID 158559504) has the molecular formula C17H16N4O4S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 3-[3-[3-(4-methylthiadiazol-5-yl)-3-oxopropyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[3-(4-methylthiadiazol-5-yl)-3-oxopropyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 158559504 |
| Molecular Formula | C17H16N4O4S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 3-[3-[3-(4-methylthiadiazol-5-yl)-3-oxopropyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione |
| SMILES | Cc1nnsc1C(=O)CCc1scc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C17H16N4O4S2/c1-8-15(27-20-19-8)12(22)3-4-13-9-6-21(17(25)10(9)7-26-13)11-2-5-14(23)18-16(11)24/h7,11H,2-6H2,1H3,(H,18,23,24) |
| InChIKey | LICYSCXNSPFNSU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|