C12H11BrN2O3S — CID 134608405
(3S)-3-(3-bromo-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)azepane-2,7-dione (PubChem CID 134608405) has the molecular formula C12H11BrN2O3S and a molecular weight of 343.20 g/mol. Its IUPAC name is (3S)-3-(3-bromo-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)azepane-2,7-dione.
| Compound Name | (3S)-3-(3-bromo-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)azepane-2,7-dione |
|---|---|
| PubChem CID | 134608405 |
| Molecular Formula | C12H11BrN2O3S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | (3S)-3-(3-bromo-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)azepane-2,7-dione |
| SMILES | O=C1CCC[C@H](N2Cc3c(csc3Br)C2=O)C(=O)N1 |
| InChI | InChI=1S/C12H11BrN2O3S/c13-10-6-4-15(12(18)7(6)5-19-10)8-2-1-3-9(16)14-11(8)17/h5,8H,1-4H2,(H,14,16,17)/t8-/m0/s1 |
| InChIKey | LGVDPTCVXGVGNN-QMMMGPOBSA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|