C22H24N2O6 — CID 148674533
8-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-6-oxooctanoic acid (PubChem CID 148674533) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is 8-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-6-oxooctanoic acid.
| Compound Name | 8-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-6-oxooctanoic acid |
|---|---|
| PubChem CID | 148674533 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 8-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-6-oxooctanoic acid |
| SMILES | C=C1CCC(N2C(=O)c3ccc(CCC(=O)CCCCC(=O)O)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H24N2O6/c1-13-6-11-18(20(28)23-13)24-21(29)16-10-8-14(12-17(16)22(24)30)7-9-15(25)4-2-3-5-19(26)27/h8,10,12,18H,1-7,9,11H2,(H,23,28)(H,26,27) |
| InChIKey | NQJOLYCQNHONEX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|