C23H29N3O6 — CID 175555281
6-[tert-butyl-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanoic acid (PubChem CID 175555281) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is 6-[tert-butyl-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanoic acid.
| Compound Name | 6-[tert-butyl-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175555281 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 6-[tert-butyl-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanoic acid |
| SMILES | CC(C)(C)N(CCCCCC(=O)O)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H29N3O6/c1-23(2,3)25(12-6-4-5-7-19(28)29)14-8-9-15-16(13-14)22(32)26(21(15)31)17-10-11-18(27)24-20(17)30/h8-9,13,17H,4-7,10-12H2,1-3H3,(H,28,29)(H,24,27,30) |
| InChIKey | UIRUDGTVVZOUMM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|