C18H16N4O3 — CID 164982701
3-(1H-indol-6-ylamino)-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione (PubChem CID 164982701) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-(1H-indol-6-ylamino)-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-6-ylamino)-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 164982701 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-(1H-indol-6-ylamino)-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrole-2,5-dione |
| SMILES | C=C1CCC(N2C(=O)C=C(Nc3ccc4cc[nH]c4c3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H16N4O3/c1-10-2-5-15(17(24)20-10)22-16(23)9-14(18(22)25)21-12-4-3-11-6-7-19-13(11)8-12/h3-4,6-9,15,19,21H,1-2,5H2,(H,20,24) |
| InChIKey | YPHXGBQXCYYWKJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|