C13H14N2O3Se — CID 159386129
3-(7-methoxy-3H-1,2-benzoselenazol-2-yl)piperidine-2,6-dione (PubChem CID 159386129) has the molecular formula C13H14N2O3Se and a molecular weight of 325.23 g/mol. Its IUPAC name is 3-(7-methoxy-3H-1,2-benzoselenazol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(7-methoxy-3H-1,2-benzoselenazol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 159386129 |
| Molecular Formula | C13H14N2O3Se |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-(7-methoxy-3H-1,2-benzoselenazol-2-yl)piperidine-2,6-dione |
| SMILES | COc1cccc2c1[Se]N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C13H14N2O3Se/c1-18-10-4-2-3-8-7-15(19-12(8)10)9-5-6-11(16)14-13(9)17/h2-4,9H,5-7H2,1H3,(H,14,16,17) |
| InChIKey | OAEFYLKCHWSISO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|