C12H11FN2OSe — CID 160593498
3-(7-fluoro-3H-1,2-benzoselenazol-2-yl)-5-methylidenepyrrolidin-2-one (PubChem CID 160593498) has the molecular formula C12H11FN2OSe and a molecular weight of 297.19 g/mol. Its IUPAC name is 3-(7-fluoro-3H-1,2-benzoselenazol-2-yl)-5-methylidenepyrrolidin-2-one.
| Compound Name | 3-(7-fluoro-3H-1,2-benzoselenazol-2-yl)-5-methylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 160593498 |
| Molecular Formula | C12H11FN2OSe |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 3-(7-fluoro-3H-1,2-benzoselenazol-2-yl)-5-methylidenepyrrolidin-2-one |
| SMILES | C=C1CC(N2Cc3cccc(F)c3[Se]2)C(=O)N1 |
| InChI | InChI=1S/C12H11FN2OSe/c1-7-5-10(12(16)14-7)15-6-8-3-2-4-9(13)11(8)17-15/h2-4,10H,1,5-6H2,(H,14,16) |
| InChIKey | VUNOHQPLCGJXIW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|