C11H11NO4Se — CID 88596821
2-(7-methoxy-3-oxo-1,2-benzoselenazol-2-yl)propanoic acid (PubChem CID 88596821) has the molecular formula C11H11NO4Se and a molecular weight of 300.17 g/mol. Its IUPAC name is 2-(7-methoxy-3-oxo-1,2-benzoselenazol-2-yl)propanoic acid.
| Compound Name | 2-(7-methoxy-3-oxo-1,2-benzoselenazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 88596821 |
| Molecular Formula | C11H11NO4Se |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-(7-methoxy-3-oxo-1,2-benzoselenazol-2-yl)propanoic acid |
| SMILES | COc1cccc2c(=O)n(C(C)C(=O)O)[se]c12 |
| InChI | InChI=1S/C11H11NO4Se/c1-6(11(14)15)12-10(13)7-4-3-5-8(16-2)9(7)17-12/h3-6H,1-2H3,(H,14,15) |
| InChIKey | VCLCOCUSPNNUSA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|