C15H10F2N2O4 — CID 155212165
2-[2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindol-1-yl]-2-oxoacetaldehyde (PubChem CID 155212165) has the molecular formula C15H10F2N2O4 and a molecular weight of 320.25 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindol-1-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindol-1-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 155212165 |
| Molecular Formula | C15H10F2N2O4 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindol-1-yl]-2-oxoacetaldehyde |
| SMILES | O=CC(=O)c1c2cc(F)c(F)cc2cn1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H10F2N2O4/c16-9-3-7-5-19(11-1-2-13(22)18-15(11)23)14(12(21)6-20)8(7)4-10(9)17/h3-6,11H,1-2H2,(H,18,22,23) |
| InChIKey | BQEZKAFTILGLFX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|