C21H24F2N4O4 — CID 170171679
2-[7-(2,6-dimethylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)-5,6-difluoro-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde (PubChem CID 170171679) has the molecular formula C21H24F2N4O4 and a molecular weight of 434.44 g/mol. Its IUPAC name is 2-[7-(2,6-dimethylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)-5,6-difluoro-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[7-(2,6-dimethylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)-5,6-difluoro-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 170171679 |
| Molecular Formula | C21H24F2N4O4 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[7-(2,6-dimethylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)-5,6-difluoro-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
| SMILES | CC1CNCC(C)N1c1c(F)c(F)cc2c1C(C(=O)C=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C21H24F2N4O4/c1-10-6-24-7-11(2)27(10)20-17-12(5-13(22)18(20)23)8-26(19(17)15(29)9-28)14-3-4-16(30)25-21(14)31/h5,9-11,14,19,24H,3-4,6-8H2,1-2H3,(H,25,30,31) |
| InChIKey | JQGBBLRXJNCLNR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|