C21H24FN3O5 — CID 170162082
2-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-5-[4-(hydroxymethyl)piperidin-1-yl]-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde (PubChem CID 170162082) has the molecular formula C21H24FN3O5 and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-5-[4-(hydroxymethyl)piperidin-1-yl]-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-5-[4-(hydroxymethyl)piperidin-1-yl]-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 170162082 |
| Molecular Formula | C21H24FN3O5 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-5-[4-(hydroxymethyl)piperidin-1-yl]-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1c2cc(F)c(N3CCC(CO)CC3)cc2CN1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H24FN3O5/c22-15-8-14-13(7-17(15)24-5-3-12(10-26)4-6-24)9-25(20(14)18(28)11-27)16-1-2-19(29)23-21(16)30/h7-8,11-12,16,20,26H,1-6,9-10H2,(H,23,29,30) |
| InChIKey | RQBGLLBTAGTOIX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|