C26H24FN5O5 — CID 176717897
[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl N-(3-indazol-1-ylcyclobutyl)carbamate (PubChem CID 176717897) has the molecular formula C26H24FN5O5 and a molecular weight of 505.51 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl N-(3-indazol-1-ylcyclobutyl)carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl N-(3-indazol-1-ylcyclobutyl)carbamate |
|---|---|
| PubChem CID | 176717897 |
| Molecular Formula | C26H24FN5O5 |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl N-(3-indazol-1-ylcyclobutyl)carbamate |
| SMILES | O=C1CCC(N2Cc3ccc(COC(=O)NC4CC(n5ncc6ccccc65)C4)c(F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H24FN5O5/c27-23-16(6-5-15-12-31(25(35)22(15)23)20-7-8-21(33)30-24(20)34)13-37-26(36)29-17-9-18(10-17)32-19-4-2-1-3-14(19)11-28-32/h1-6,11,17-18,20H,7-10,12-13H2,(H,29,36)(H,30,33,34) |
| InChIKey | DRQVRUCPCWVAJH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|