C28H23N5O4 — CID 167780032
N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-4-indazol-1-ylbenzamide (PubChem CID 167780032) has the molecular formula C28H23N5O4 and a molecular weight of 493.52 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-4-indazol-1-ylbenzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-4-indazol-1-ylbenzamide |
|---|---|
| PubChem CID | 167780032 |
| Molecular Formula | C28H23N5O4 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-4-indazol-1-ylbenzamide |
| SMILES | O=C1CCC(N2Cc3ccc(CNC(=O)c4ccc(-n5ncc6ccccc65)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H23N5O4/c34-25-12-11-24(27(36)31-25)32-16-20-6-5-17(13-22(20)28(32)37)14-29-26(35)18-7-9-21(10-8-18)33-23-4-2-1-3-19(23)15-30-33/h1-10,13,15,24H,11-12,14,16H2,(H,29,35)(H,31,34,36) |
| InChIKey | LGUHUYSRYHYGGY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|