C23H20N4O5S — CID 176717831
1,3-benzothiazol-2-ylmethyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate (PubChem CID 176717831) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 176717831 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate |
| SMILES | O=C1CCC(N2Cc3ccc(CNC(=O)OCc4nc5ccccc5s4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H20N4O5S/c28-19-8-7-17(21(29)26-19)27-11-14-6-5-13(9-15(14)22(27)30)10-24-23(31)32-12-20-25-16-3-1-2-4-18(16)33-20/h1-6,9,17H,7-8,10-12H2,(H,24,31)(H,26,28,29) |
| InChIKey | IDMQAYPBFWKNRB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|