C24H23N5O4S — CID 167777917
1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[(5-methyl-1,3-benzothiazol-2-yl)methyl]urea (PubChem CID 167777917) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[(5-methyl-1,3-benzothiazol-2-yl)methyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[(5-methyl-1,3-benzothiazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 167777917 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-3-[(5-methyl-1,3-benzothiazol-2-yl)methyl]urea |
| SMILES | Cc1ccc2sc(CNC(=O)NCc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nc2c1 |
| InChI | InChI=1S/C24H23N5O4S/c1-13-2-6-19-17(8-13)27-21(34-19)11-26-24(33)25-10-14-3-4-16-15(9-14)12-29(23(16)32)18-5-7-20(30)28-22(18)31/h2-4,6,8-9,18H,5,7,10-12H2,1H3,(H2,25,26,33)(H,28,30,31) |
| InChIKey | KBGKQVJRLFFFCG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|