C33H30N5O5P — CID 167276257
2-(2,6-dioxopiperidin-3-yl)-N-[[4-[[(2-isoquinolin-1-ylacetyl)amino]methyl]-2-phosphanylphenyl]methyl]-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 167276257) has the molecular formula C33H30N5O5P and a molecular weight of 607.61 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-[[4-[[(2-isoquinolin-1-ylacetyl)amino]methyl]-2-phosphanylphenyl]methyl]-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-[[4-[[(2-isoquinolin-1-ylacetyl)amino]methyl]-2-phosphanylphenyl]methyl]-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 167276257 |
| Molecular Formula | C33H30N5O5P |
| Molecular Weight | 607.61 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-[[4-[[(2-isoquinolin-1-ylacetyl)amino]methyl]-2-phosphanylphenyl]methyl]-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | O=C(Cc1nccc2ccccc12)NCc1ccc(CNC(=O)c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c(P)c1 |
| InChI | InChI=1S/C33H30N5O5P/c39-29-10-9-27(32(42)37-29)38-18-23-14-21(7-8-25(23)33(38)43)31(41)36-17-22-6-5-19(13-28(22)44)16-35-30(40)15-26-24-4-2-1-3-20(24)11-12-34-26/h1-8,11-14,27H,9-10,15-18,44H2,(H,35,40)(H,36,41)(H,37,39,42) |
| InChIKey | AREFRWDPWSTXTE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.61 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|