C22H22N6O4 — CID 167754996
4-(cyclopropylamino)-N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]pyrimidine-2-carboxamide (PubChem CID 167754996) has the molecular formula C22H22N6O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]pyrimidine-2-carboxamide.
| Compound Name | 4-(cyclopropylamino)-N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 167754996 |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 4-(cyclopropylamino)-N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]pyrimidine-2-carboxamide |
| SMILES | O=C1CCC(N2Cc3ccc(CNC(=O)c4nccc(NC5CC5)n4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H22N6O4/c29-18-6-5-16(20(30)27-18)28-11-13-2-1-12(9-15(13)22(28)32)10-24-21(31)19-23-8-7-17(26-19)25-14-3-4-14/h1-2,7-9,14,16H,3-6,10-11H2,(H,24,31)(H,23,25,26)(H,27,29,30) |
| InChIKey | DKVQQNWTVPBQNN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|