C23H21FN5O7+ — CID 176717704
(3-methyl-1-oxo-2H-benzimidazol-1-ium-4-yl) N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl]carbamoperoxoate (PubChem CID 176717704) has the molecular formula C23H21FN5O7+ and a molecular weight of 498.45 g/mol. Its IUPAC name is (3-methyl-1-oxo-2H-benzimidazol-1-ium-4-yl) N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl]carbamoperoxoate.
| Compound Name | (3-methyl-1-oxo-2H-benzimidazol-1-ium-4-yl) N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl]carbamoperoxoate |
|---|---|
| PubChem CID | 176717704 |
| Molecular Formula | C23H21FN5O7+ |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (3-methyl-1-oxo-2H-benzimidazol-1-ium-4-yl) N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl]carbamoperoxoate |
| SMILES | CN1C[N+](=O)c2cccc(OOC(=O)NCc3ccc4c(c3F)C(=O)N(C3CCC(=O)NC3=O)C4)c21 |
| InChI | InChI=1S/C23H20FN5O7/c1-27-11-29(34)14-3-2-4-16(20(14)27)35-36-23(33)25-9-12-5-6-13-10-28(22(32)18(13)19(12)24)15-7-8-17(30)26-21(15)31/h2-6,15H,7-11H2,1H3,(H-,25,26,30,31,33)/p+1 |
| InChIKey | YXGWHTDTFGCBJF-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|