C27H30N4O6 — CID 170177170
tert-butyl N-[(1S)-2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]methylamino]-2-oxo-1-phenylethyl]carbamate (PubChem CID 170177170) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]methylamino]-2-oxo-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]methylamino]-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 170177170 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | tert-butyl N-[(1S)-2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]methylamino]-2-oxo-1-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)NCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2)c1ccccc1 |
| InChI | InChI=1S/C27H30N4O6/c1-27(2,3)37-26(36)30-22(16-8-5-4-6-9-16)24(34)28-14-17-10-7-11-18-15-31(25(35)21(17)18)19-12-13-20(32)29-23(19)33/h4-11,19,22H,12-15H2,1-3H3,(H,28,34)(H,30,36)(H,29,32,33)/t19?,22-/m0/s1 |
| InChIKey | GEAPXNJXSPVMMX-BPARTEKVSA-N |
| XLogP | 2.33 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|