C25H28N4O4 — CID 167728549
3-[4-[[[[(3R,4S)-4-aminooxolan-3-yl]-phenylmethyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167728549) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-[4-[[[[(3R,4S)-4-aminooxolan-3-yl]-phenylmethyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[[[(3R,4S)-4-aminooxolan-3-yl]-phenylmethyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167728549 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-[4-[[[[(3R,4S)-4-aminooxolan-3-yl]-phenylmethyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | N[C@@H]1COC[C@H]1C(NCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O4/c26-19-14-33-13-18(19)23(15-5-2-1-3-6-15)27-11-16-7-4-8-17-12-29(25(32)22(16)17)20-9-10-21(30)28-24(20)31/h1-8,18-20,23,27H,9-14,26H2,(H,28,30,31)/t18-,19-,20?,23?/m1/s1 |
| InChIKey | LLQBLKPHNFIOSX-SSPASSIJSA-N |
| XLogP | 1.25 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|