C24H26F4N5O6+ — CID 176718055
[3-[3-methyl-2-oxo-5-(trifluoromethyl)pyrazolidin-2-ium-1-yl]cyclobutyl] N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl]carbamate (PubChem CID 176718055) has the molecular formula C24H26F4N5O6+ and a molecular weight of 556.49 g/mol. Its IUPAC name is [3-[3-methyl-2-oxo-5-(trifluoromethyl)pyrazolidin-2-ium-1-yl]cyclobutyl] N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl]carbamate.
| Compound Name | [3-[3-methyl-2-oxo-5-(trifluoromethyl)pyrazolidin-2-ium-1-yl]cyclobutyl] N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 176718055 |
| Molecular Formula | C24H26F4N5O6+ |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | [3-[3-methyl-2-oxo-5-(trifluoromethyl)pyrazolidin-2-ium-1-yl]cyclobutyl] N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-3-oxo-1H-isoindol-5-yl]methyl]carbamate |
| SMILES | CC1CC(C(F)(F)F)N(C2CC(OC(=O)NCc3ccc4c(c3F)C(=O)N(C3CCC(=O)NC3=O)C4)C2)[N+]1=O |
| InChI | InChI=1S/C24H25F4N5O6/c1-11-6-17(24(26,27)28)32(33(11)38)14-7-15(8-14)39-23(37)29-9-12-2-3-13-10-31(22(36)19(13)20(12)25)16-4-5-18(34)30-21(16)35/h2-3,11,14-17H,4-10H2,1H3,(H-,29,30,34,35,37)/p+1 |
| InChIKey | NGMGBTLGOZGAPP-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|