C26H28N4O5 — CID 167733899
phenyl N-[1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]piperidin-4-yl]carbamate (PubChem CID 167733899) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is phenyl N-[1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]piperidin-4-yl]carbamate.
| Compound Name | phenyl N-[1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 167733899 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | phenyl N-[1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]piperidin-4-yl]carbamate |
| SMILES | O=C1CCC(N2Cc3ccc(CN4CCC(NC(=O)Oc5ccccc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H28N4O5/c31-23-9-8-22(24(32)28-23)30-16-18-7-6-17(14-21(18)25(30)33)15-29-12-10-19(11-13-29)27-26(34)35-20-4-2-1-3-5-20/h1-7,14,19,22H,8-13,15-16H2,(H,27,34)(H,28,31,32) |
| InChIKey | WHYZQQLJBFCRAH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|