C24H34N4O3 — CID 167714658
3-[5-[[4-(3-amino-3-methylbutyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167714658) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 3-[5-[[4-(3-amino-3-methylbutyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[4-(3-amino-3-methylbutyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167714658 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 3-[5-[[4-(3-amino-3-methylbutyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)(N)CCC1CCN(Cc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)CC1 |
| InChI | InChI=1S/C24H34N4O3/c1-24(2,25)10-7-16-8-11-27(12-9-16)14-17-3-4-18-15-28(23(31)19(18)13-17)20-5-6-21(29)26-22(20)30/h3-4,13,16,20H,5-12,14-15,25H2,1-2H3,(H,26,29,30) |
| InChIKey | KNZSEXFCYCUNGJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|