C14H12N4O2 — CID 153390252
3-(2,4,12-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaen-4-yl)piperidine-2,6-dione (PubChem CID 153390252) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-(2,4,12-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaen-4-yl)piperidine-2,6-dione.
| Compound Name | 3-(2,4,12-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaen-4-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 153390252 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-(2,4,12-triazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaen-4-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2ccc3cc4cc[nH]c4nc32)C(=O)N1 |
| InChI | InChI=1S/C14H12N4O2/c19-11-2-1-10(14(20)16-11)18-6-4-9-7-8-3-5-15-12(8)17-13(9)18/h3-7,10H,1-2H2,(H,15,17)(H,16,19,20) |
| InChIKey | IOYGELZCQUNWLA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|