C26H26FN5O3 — CID 169309980
3-[5-fluoro-3-oxo-7-[1-(1H-pyrrolo[2,3-b]pyridin-6-ylmethyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309980) has the molecular formula C26H26FN5O3 and a molecular weight of 475.52 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-7-[1-(1H-pyrrolo[2,3-b]pyridin-6-ylmethyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-7-[1-(1H-pyrrolo[2,3-b]pyridin-6-ylmethyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309980 |
| Molecular Formula | C26H26FN5O3 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-[5-fluoro-3-oxo-7-[1-(1H-pyrrolo[2,3-b]pyridin-6-ylmethyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3C3CCN(Cc4ccc5cc[nH]c5n4)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H26FN5O3/c27-17-11-19(21-14-32(26(35)20(21)12-17)22-3-4-23(33)30-25(22)34)15-6-9-31(10-7-15)13-18-2-1-16-5-8-28-24(16)29-18/h1-2,5,8,11-12,15,22H,3-4,6-7,9-10,13-14H2,(H,28,29)(H,30,33,34) |
| InChIKey | UAENJPMKBZRLSM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|