C24H25NO4 — CID 59452502
2,3,7-trimethoxy-11,12,13,14,14a,15-hexahydrophenanthro[9,10-b]quinolizin-9-one (PubChem CID 59452502) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2,3,7-trimethoxy-11,12,13,14,14a,15-hexahydrophenanthro[9,10-b]quinolizin-9-one.
| Compound Name | 2,3,7-trimethoxy-11,12,13,14,14a,15-hexahydrophenanthro[9,10-b]quinolizin-9-one |
|---|---|
| PubChem CID | 59452502 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2,3,7-trimethoxy-11,12,13,14,14a,15-hexahydrophenanthro[9,10-b]quinolizin-9-one |
| SMILES | COc1ccc2c(c1)c1c(c3cc(OC)c(OC)cc32)CC2CCCCN2C1=O |
| InChI | InChI=1S/C24H25NO4/c1-27-15-7-8-16-17-12-21(28-2)22(29-3)13-18(17)19-10-14-6-4-5-9-25(14)24(26)23(19)20(16)11-15/h7-8,11-14H,4-6,9-10H2,1-3H3 |
| InChIKey | TYXLMENTCLRDDC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|