C29H25NO5 — CID 51050303
(13aS)-6,7-dimethoxy-3-phenylmethoxy-9,12,13,13a-tetrahydrophenanthro[9,10-f]indolizine-11,14-dione (PubChem CID 51050303) has the molecular formula C29H25NO5 and a molecular weight of 467.52 g/mol. Its IUPAC name is (13aS)-6,7-dimethoxy-3-phenylmethoxy-9,12,13,13a-tetrahydrophenanthro[9,10-f]indolizine-11,14-dione.
| Compound Name | (13aS)-6,7-dimethoxy-3-phenylmethoxy-9,12,13,13a-tetrahydrophenanthro[9,10-f]indolizine-11,14-dione |
|---|---|
| PubChem CID | 51050303 |
| Molecular Formula | C29H25NO5 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (13aS)-6,7-dimethoxy-3-phenylmethoxy-9,12,13,13a-tetrahydrophenanthro[9,10-f]indolizine-11,14-dione |
| SMILES | COc1cc2c3c(c4ccc(OCc5ccccc5)cc4c2cc1OC)C(=O)[C@@H]1CCC(=O)N1C3 |
| InChI | InChI=1S/C29H25NO5/c1-33-25-13-21-20-12-18(35-16-17-6-4-3-5-7-17)8-9-19(20)28-23(22(21)14-26(25)34-2)15-30-24(29(28)32)10-11-27(30)31/h3-9,12-14,24H,10-11,15-16H2,1-2H3/t24-/m0/s1 |
| InChIKey | XMZFTZZCTNLNBW-DEOSSOPVSA-N |
| XLogP | 5.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|