C29H26N4O4 — CID 40911214
(8S)-6-[(Z)-(2-methoxy-4-phenylmethoxyphenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 40911214) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is (8S)-6-[(Z)-(2-methoxy-4-phenylmethoxyphenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (8S)-6-[(Z)-(2-methoxy-4-phenylmethoxyphenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 40911214 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | (8S)-6-[(Z)-(2-methoxy-4-phenylmethoxyphenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1cc(OCc2ccccc2)ccc1/C=N\N1CC(=O)N2Cc3[nH]c4ccccc4c3C[C@H]2C1=O |
| InChI | InChI=1S/C29H26N4O4/c1-36-27-13-21(37-18-19-7-3-2-4-8-19)12-11-20(27)15-30-33-17-28(34)32-16-25-23(14-26(32)29(33)35)22-9-5-6-10-24(22)31-25/h2-13,15,26,31H,14,16-18H2,1H3/b30-15-/t26-/m0/s1 |
| InChIKey | XQDDBEJMLHESFY-GRXZTXSZSA-N |
| XLogP | 3.89 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|