C24H25NO5 — CID 11315764
(13aS)-2,3,6,7-tetramethoxy-11,12,13,13a-tetrahydro-9H-phenanthro[9,10-f]indolizin-14-one (PubChem CID 11315764) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is (13aS)-2,3,6,7-tetramethoxy-11,12,13,13a-tetrahydro-9H-phenanthro[9,10-f]indolizin-14-one.
| Compound Name | (13aS)-2,3,6,7-tetramethoxy-11,12,13,13a-tetrahydro-9H-phenanthro[9,10-f]indolizin-14-one |
|---|---|
| PubChem CID | 11315764 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (13aS)-2,3,6,7-tetramethoxy-11,12,13,13a-tetrahydro-9H-phenanthro[9,10-f]indolizin-14-one |
| SMILES | COc1cc2c3c(c4cc(OC)c(OC)cc4c2cc1OC)C(=O)[C@@H]1CCCN1C3 |
| InChI | InChI=1S/C24H25NO5/c1-27-19-8-13-14-9-20(28-2)22(30-4)11-16(14)23-17(15(13)10-21(19)29-3)12-25-7-5-6-18(25)24(23)26/h8-11,18H,5-7,12H2,1-4H3/t18-/m0/s1 |
| InChIKey | UJOGCRIJEBLXDO-SFHVURJKSA-N |
| XLogP | 4.19 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|