C18H16NO5+ — CID 14502433
6,7-dimethoxy-3-methyl-1-(4-nitrophenyl)isochromenylium (PubChem CID 14502433) has the molecular formula C18H16NO5+ and a molecular weight of 326.33 g/mol. Its IUPAC name is 6,7-dimethoxy-3-methyl-1-(4-nitrophenyl)isochromenylium.
| Compound Name | 6,7-dimethoxy-3-methyl-1-(4-nitrophenyl)isochromenylium |
|---|---|
| PubChem CID | 14502433 |
| Molecular Formula | C18H16NO5+ |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 6,7-dimethoxy-3-methyl-1-(4-nitrophenyl)isochromenylium |
| SMILES | COc1cc2cc(C)[o+]c(-c3ccc([N+](=O)[O-])cc3)c2cc1OC |
| InChI | InChI=1S/C18H16NO5/c1-11-8-13-9-16(22-2)17(23-3)10-15(13)18(24-11)12-4-6-14(7-5-12)19(20)21/h4-10H,1-3H3/q+1 |
| InChIKey | BOERZGUKHACEME-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|