C22H22NO5+ — CID 173306661
4-ethyl-6,7-dimethoxy-3-methyl-1-[2-(4-nitrophenyl)ethenyl]isochromenylium (PubChem CID 173306661) has the molecular formula C22H22NO5+ and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-ethyl-6,7-dimethoxy-3-methyl-1-[2-(4-nitrophenyl)ethenyl]isochromenylium.
| Compound Name | 4-ethyl-6,7-dimethoxy-3-methyl-1-[2-(4-nitrophenyl)ethenyl]isochromenylium |
|---|---|
| PubChem CID | 173306661 |
| Molecular Formula | C22H22NO5+ |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-ethyl-6,7-dimethoxy-3-methyl-1-[2-(4-nitrophenyl)ethenyl]isochromenylium |
| SMILES | CCc1c(C)[o+]c(C=Cc2ccc([N+](=O)[O-])cc2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C22H22NO5/c1-5-17-14(2)28-20(11-8-15-6-9-16(10-7-15)23(24)25)19-13-22(27-4)21(26-3)12-18(17)19/h6-13H,5H2,1-4H3/q+1 |
| InChIKey | BMHUEPVHDTZMAE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 72.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|