C15H15NO8S — CID 87978454
3,4,5-trimethoxy-2-(4-nitrophenyl)benzenesulfonic acid (PubChem CID 87978454) has the molecular formula C15H15NO8S and a molecular weight of 369.35 g/mol. Its IUPAC name is 3,4,5-trimethoxy-2-(4-nitrophenyl)benzenesulfonic acid.
| Compound Name | 3,4,5-trimethoxy-2-(4-nitrophenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 87978454 |
| Molecular Formula | C15H15NO8S |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 3,4,5-trimethoxy-2-(4-nitrophenyl)benzenesulfonic acid |
| SMILES | COc1cc(S(=O)(=O)O)c(-c2ccc([N+](=O)[O-])cc2)c(OC)c1OC |
| InChI | InChI=1S/C15H15NO8S/c1-22-11-8-12(25(19,20)21)13(15(24-3)14(11)23-2)9-4-6-10(7-5-9)16(17)18/h4-8H,1-3H3,(H,19,20,21) |
| InChIKey | BBHWFSOPNAPKQI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|