C19H16N4O4 — CID 139490492
7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline (PubChem CID 139490492) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline.
| Compound Name | 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 139490492 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline |
| SMILES | COc1cc2ncc3nc(-c4ccc([N+](=O)[O-])cc4)n(C)c3c2cc1OC |
| InChI | InChI=1S/C19H16N4O4/c1-22-18-13-8-16(26-2)17(27-3)9-14(13)20-10-15(18)21-19(22)11-4-6-12(7-5-11)23(24)25/h4-10H,1-3H3 |
| InChIKey | VUHPMVNAUBZQIR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|