About 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline
7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline (PubChem CID 139490492) has the molecular formula C19H16N4O4
and a molecular weight of 364.36 g/mol. Its IUPAC name is 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline |
| PubChem CID | 139490492 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline |
| SMILES | COc1cc2ncc3nc(-c4ccc([N+](=O)[O-])cc4)n(C)c3c2cc1OC |
| InChI | InChI=1S/C19H16N4O4/c1-22-18-13-8-16(26-2)17(27-3)9-14(13)20-10-15(18)21-19(22)11-4-6-12(7-5-11)23(24)25/h4-10H,1-3H3 |
| InChIKey | VUHPMVNAUBZQIR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline?
The IUPAC name of 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline (CID 139490492) is 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline.
What is the SMILES notation for 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline?
The canonical SMILES for 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline is COc1cc2ncc3nc(-c4ccc([N+](=O)[O-])cc4)n(C)c3c2cc1OC.
What is the InChIKey of 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline?
The InChIKey is VUHPMVNAUBZQIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O4/c1-22-18-13-8-16(26-2)17(27-3)9-14(13)20-10-15(18)21-19(22)11-4-6-12(7-5-11)23(24)25/h4-10H,1-3H3.
What are the key properties of 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline?
7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline has a molecular weight of 364.36 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethoxy-1-methyl-2-(4-nitrophenyl)imidazo[4,5-c]quinoline is sourced from PubChem (CID 139490492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).