C18H12FN3O5 — CID 69294993
4-(2-fluoro-4-nitrophenoxy)-6,7-dimethoxyquinoline-3-carbonitrile (PubChem CID 69294993) has the molecular formula C18H12FN3O5 and a molecular weight of 369.31 g/mol. Its IUPAC name is 4-(2-fluoro-4-nitrophenoxy)-6,7-dimethoxyquinoline-3-carbonitrile.
| Compound Name | 4-(2-fluoro-4-nitrophenoxy)-6,7-dimethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 69294993 |
| Molecular Formula | C18H12FN3O5 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-(2-fluoro-4-nitrophenoxy)-6,7-dimethoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(Oc3ccc([N+](=O)[O-])cc3F)c2cc1OC |
| InChI | InChI=1S/C18H12FN3O5/c1-25-16-6-12-14(7-17(16)26-2)21-9-10(8-20)18(12)27-15-4-3-11(22(23)24)5-13(15)19/h3-7,9H,1-2H3 |
| InChIKey | LMIKVMKNWZXVDY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 107.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|