C19H18N3O5P — CID 163399453
[4-(7,8-dimethoxy-1-methylimidazo[4,5-c]quinolin-2-yl)phenyl]phosphonic acid (PubChem CID 163399453) has the molecular formula C19H18N3O5P and a molecular weight of 399.34 g/mol. Its IUPAC name is [4-(7,8-dimethoxy-1-methylimidazo[4,5-c]quinolin-2-yl)phenyl]phosphonic acid.
| Compound Name | [4-(7,8-dimethoxy-1-methylimidazo[4,5-c]quinolin-2-yl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 163399453 |
| Molecular Formula | C19H18N3O5P |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [4-(7,8-dimethoxy-1-methylimidazo[4,5-c]quinolin-2-yl)phenyl]phosphonic acid |
| SMILES | COc1cc2ncc3nc(-c4ccc(P(=O)(O)O)cc4)n(C)c3c2cc1OC |
| InChI | InChI=1S/C19H18N3O5P/c1-22-18-13-8-16(26-2)17(27-3)9-14(13)20-10-15(18)21-19(22)11-4-6-12(7-5-11)28(23,24)25/h4-10H,1-3H3,(H2,23,24,25) |
| InChIKey | SSGIZMDGMDZCOA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|