C20H20N3O6P — CID 163399444
[4-[(7,8-dimethoxy-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]phosphonic acid (PubChem CID 163399444) has the molecular formula C20H20N3O6P and a molecular weight of 429.37 g/mol. Its IUPAC name is [4-[(7,8-dimethoxy-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]phosphonic acid.
| Compound Name | [4-[(7,8-dimethoxy-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 163399444 |
| Molecular Formula | C20H20N3O6P |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | [4-[(7,8-dimethoxy-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]phosphonic acid |
| SMILES | COc1cc2ncc3c(c2cc1OC)n(Cc1ccc(P(=O)(O)O)cc1)c(=O)n3C |
| InChI | InChI=1S/C20H20N3O6P/c1-22-16-10-21-15-9-18(29-3)17(28-2)8-14(15)19(16)23(20(22)24)11-12-4-6-13(7-5-12)30(25,26)27/h4-10H,11H2,1-3H3,(H2,25,26,27) |
| InChIKey | YIQMKEHUSQYIMT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|