C21H18N4O5 — CID 162717000
6-(4-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)benzotriazole (PubChem CID 162717000) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)benzotriazole.
| Compound Name | 6-(4-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)benzotriazole |
|---|---|
| PubChem CID | 162717000 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 6-(4-nitrophenyl)-1-(3,4,5-trimethoxyphenyl)benzotriazole |
| SMILES | COc1cc(-n2nnc3ccc(-c4ccc([N+](=O)[O-])cc4)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C21H18N4O5/c1-28-19-11-16(12-20(29-2)21(19)30-3)24-18-10-14(6-9-17(18)22-23-24)13-4-7-15(8-5-13)25(26)27/h4-12H,1-3H3 |
| InChIKey | FIXLZHNPNLYFGZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|