C19H16N6O5 — CID 155809315
2-(3,4-dimethoxyphenyl)-5-[5-methyl-1-(4-nitrophenyl)triazol-4-yl]-1,3,4-oxadiazole (PubChem CID 155809315) has the molecular formula C19H16N6O5 and a molecular weight of 408.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-[5-methyl-1-(4-nitrophenyl)triazol-4-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-[5-methyl-1-(4-nitrophenyl)triazol-4-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155809315 |
| Molecular Formula | C19H16N6O5 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-[5-methyl-1-(4-nitrophenyl)triazol-4-yl]-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2nnc(-c3nnn(-c4ccc([N+](=O)[O-])cc4)c3C)o2)cc1OC |
| InChI | InChI=1S/C19H16N6O5/c1-11-17(20-23-24(11)13-5-7-14(8-6-13)25(26)27)19-22-21-18(30-19)12-4-9-15(28-2)16(10-12)29-3/h4-10H,1-3H3 |
| InChIKey | GWPCUNYZNSDQRX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 131.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|