C18H18N4O6 — CID 59430032
1-(4-nitrophenyl)-5-(2,3,4,5-tetramethoxyphenyl)triazole (PubChem CID 59430032) has the molecular formula C18H18N4O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-5-(2,3,4,5-tetramethoxyphenyl)triazole.
| Compound Name | 1-(4-nitrophenyl)-5-(2,3,4,5-tetramethoxyphenyl)triazole |
|---|---|
| PubChem CID | 59430032 |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-(4-nitrophenyl)-5-(2,3,4,5-tetramethoxyphenyl)triazole |
| SMILES | COc1cc(-c2cnnn2-c2ccc([N+](=O)[O-])cc2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C18H18N4O6/c1-25-15-9-13(16(26-2)18(28-4)17(15)27-3)14-10-19-20-21(14)11-5-7-12(8-6-11)22(23)24/h5-10H,1-4H3 |
| InChIKey | SSEJMFZNJOQVND-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|