C20H22N4O2 — CID 59430215
5-(4-nitrophenyl)-1-(3,4,5-triethylphenyl)triazole (PubChem CID 59430215) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-1-(3,4,5-triethylphenyl)triazole.
| Compound Name | 5-(4-nitrophenyl)-1-(3,4,5-triethylphenyl)triazole |
|---|---|
| PubChem CID | 59430215 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 5-(4-nitrophenyl)-1-(3,4,5-triethylphenyl)triazole |
| SMILES | CCc1cc(-n2nncc2-c2ccc([N+](=O)[O-])cc2)cc(CC)c1CC |
| InChI | InChI=1S/C20H22N4O2/c1-4-14-11-18(12-15(5-2)19(14)6-3)23-20(13-21-22-23)16-7-9-17(10-8-16)24(25)26/h7-13H,4-6H2,1-3H3 |
| InChIKey | GLXPZARVBOWKKU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|