C17H16N4O4 — CID 88580137
5-(4-nitrosophenyl)-1-(3,4,5-trimethoxyphenyl)triazole (PubChem CID 88580137) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 5-(4-nitrosophenyl)-1-(3,4,5-trimethoxyphenyl)triazole.
| Compound Name | 5-(4-nitrosophenyl)-1-(3,4,5-trimethoxyphenyl)triazole |
|---|---|
| PubChem CID | 88580137 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-(4-nitrosophenyl)-1-(3,4,5-trimethoxyphenyl)triazole |
| SMILES | COc1cc(-n2nncc2-c2ccc(N=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16N4O4/c1-23-15-8-13(9-16(24-2)17(15)25-3)21-14(10-18-20-21)11-4-6-12(19-22)7-5-11/h4-10H,1-3H3 |
| InChIKey | YQCDVZZRSKMLEV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |