C11H10Cl3NO4 — CID 121221211
6-methoxy-3-nitro-4-(trichloromethyl)-3,4-dihydro-2H-chromene (PubChem CID 121221211) has the molecular formula C11H10Cl3NO4 and a molecular weight of 326.56 g/mol. Its IUPAC name is 6-methoxy-3-nitro-4-(trichloromethyl)-3,4-dihydro-2H-chromene.
| Compound Name | 6-methoxy-3-nitro-4-(trichloromethyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 121221211 |
| Molecular Formula | C11H10Cl3NO4 |
| Molecular Weight | 326.56 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 6-methoxy-3-nitro-4-(trichloromethyl)-3,4-dihydro-2H-chromene |
| SMILES | COc1ccc2c(c1)C(C(Cl)(Cl)Cl)C([N+](=O)[O-])CO2 |
| InChI | InChI=1S/C11H10Cl3NO4/c1-18-6-2-3-9-7(4-6)10(11(12,13)14)8(5-19-9)15(16)17/h2-4,8,10H,5H2,1H3 |
| InChIKey | OBWLTJZMAMGAMJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|