C25H33F3N2O2 — CID 145071201
8,9-dimethoxy-1,2,3,4-tetrahydrobenzo[f]quinolin-2-amine;ethane;1,2,4-trifluorobenzene (PubChem CID 145071201) has the molecular formula C25H33F3N2O2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 8,9-dimethoxy-1,2,3,4-tetrahydrobenzo[f]quinolin-2-amine;ethane;1,2,4-trifluorobenzene.
| Compound Name | 8,9-dimethoxy-1,2,3,4-tetrahydrobenzo[f]quinolin-2-amine;ethane;1,2,4-trifluorobenzene |
|---|---|
| PubChem CID | 145071201 |
| Molecular Formula | C25H33F3N2O2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 8,9-dimethoxy-1,2,3,4-tetrahydrobenzo[f]quinolin-2-amine;ethane;1,2,4-trifluorobenzene |
| SMILES | CC.CC.COc1cc2ccc3c(c2cc1OC)CC(N)CN3.Fc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H18N2O2.C6H3F3.2C2H6/c1-18-14-5-9-3-4-13-12(6-10(16)8-17-13)11(9)7-15(14)19-2;7-4-1-2-5(8)6(9)3-4;2*1-2/h3-5,7,10,17H,6,8,16H2,1-2H3;1-3H;2*1-2H3 |
| InChIKey | AKPAZSWRYSPYRZ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|