C21H14F3NO2 — CID 166887958
9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile (PubChem CID 166887958) has the molecular formula C21H14F3NO2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile.
| Compound Name | 9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile |
|---|---|
| PubChem CID | 166887958 |
| Molecular Formula | C21H14F3NO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile |
| SMILES | COc1cc2c3c(ccc2cc1C#N)OC(c1cc(F)c(F)cc1F)CC3 |
| InChI | InChI=1S/C21H14F3NO2/c1-26-21-8-14-11(6-12(21)10-25)2-4-19-13(14)3-5-20(27-19)15-7-17(23)18(24)9-16(15)22/h2,4,6-9,20H,3,5H2,1H3 |
| InChIKey | ZRDYDUHAHSCQLR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|