C20H18FNO2 — CID 166887924
3-(3-fluorophenyl)-9-methoxy-2,3-dihydro-1H-benzo[f]chromen-2-amine (PubChem CID 166887924) has the molecular formula C20H18FNO2 and a molecular weight of 323.37 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-9-methoxy-2,3-dihydro-1H-benzo[f]chromen-2-amine.
| Compound Name | 3-(3-fluorophenyl)-9-methoxy-2,3-dihydro-1H-benzo[f]chromen-2-amine |
|---|---|
| PubChem CID | 166887924 |
| Molecular Formula | C20H18FNO2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-(3-fluorophenyl)-9-methoxy-2,3-dihydro-1H-benzo[f]chromen-2-amine |
| SMILES | COc1ccc2ccc3c(c2c1)CC(N)C(c1cccc(F)c1)O3 |
| InChI | InChI=1S/C20H18FNO2/c1-23-15-7-5-12-6-8-19-17(16(12)10-15)11-18(22)20(24-19)13-3-2-4-14(21)9-13/h2-10,18,20H,11,22H2,1H3 |
| InChIKey | OXGOYXKLVFBWRT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |