C17H16O3S — CID 163478631
2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid (PubChem CID 163478631) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid.
| Compound Name | 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid |
|---|---|
| PubChem CID | 163478631 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid |
| SMILES | COc1ccc2c(c1)CCC(c1ccccc1S(=O)O)=C2 |
| InChI | InChI=1S/C17H16O3S/c1-20-15-9-8-12-10-14(7-6-13(12)11-15)16-4-2-3-5-17(16)21(18)19/h2-5,8-11H,6-7H2,1H3,(H,18,19) |
| InChIKey | CCQHBKMVGJAPHK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|