2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid

C17H16O3S — CID 163478631

IUPAC2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid
SMILESCOc1ccc2c(c1)CCC(c1ccccc1S(=O)O)=C2
InChIInChI=1S/C17H16O3S/c1-20-15-9-8-12-10-14(7-6-13(12)11-15)16-4-2-3-5-17(16)21(18)19/h2-5,8-11H,6-7H2,1H3,(H,18,19)
InChIKeyCCQHBKMVGJAPHK-UHFFFAOYSA-N
MW300.38 g/mol
LogP3.76
Rot. Bonds3

About 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid

2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid (PubChem CID 163478631) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid.

Molecular Properties

Compound Name2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid
PubChem CID163478631
Molecular FormulaC17H16O3S
Molecular Weight300.38 g/mol
Exact Mass300.08
IUPAC Name2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid
SMILESCOc1ccc2c(c1)CCC(c1ccccc1S(=O)O)=C2
InChIInChI=1S/C17H16O3S/c1-20-15-9-8-12-10-14(7-6-13(12)11-15)16-4-2-3-5-17(16)21(18)19/h2-5,8-11H,6-7H2,1H3,(H,18,19)
InChIKeyCCQHBKMVGJAPHK-UHFFFAOYSA-N
XLogP3.76
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.38
LogP ≤ 53.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid?
The IUPAC name of 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid (CID 163478631) is 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid.
What is the SMILES notation for 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid?
The canonical SMILES for 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid is COc1ccc2c(c1)CCC(c1ccccc1S(=O)O)=C2.
What is the InChIKey of 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid?
The InChIKey is CCQHBKMVGJAPHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3S/c1-20-15-9-8-12-10-14(7-6-13(12)11-15)16-4-2-3-5-17(16)21(18)19/h2-5,8-11H,6-7H2,1H3,(H,18,19).
What are the key properties of 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid?
2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid has a molecular weight of 300.38 g/mol, XLogP of 3.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methoxy-3,4-dihydronaphthalen-2-yl)benzenesulfinic acid is sourced from PubChem (CID 163478631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).