C18H18O3 — CID 624777
3,5,13-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,8,12,14-heptaene (PubChem CID 624777) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3,5,13-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,8,12,14-heptaene.
| Compound Name | 3,5,13-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,8,12,14-heptaene |
|---|---|
| PubChem CID | 624777 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3,5,13-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,8,12,14-heptaene |
| SMILES | COc1ccc2c(c1)CC=Cc1cc(OC)cc(OC)c1-2 |
| InChI | InChI=1S/C18H18O3/c1-19-14-7-8-16-12(9-14)5-4-6-13-10-15(20-2)11-17(21-3)18(13)16/h4,6-11H,5H2,1-3H3 |
| InChIKey | ZZMREAGPBLYKIS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |